C18H26Cl2N4 — CID 120758162
2-[[2-(4-ethylphenyl)piperazin-1-yl]methyl]-5-methylpyrazine;dihydrochloride (PubChem CID 120758162) has the molecular formula C18H26Cl2N4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-[[2-(4-ethylphenyl)piperazin-1-yl]methyl]-5-methylpyrazine;dihydrochloride.
| Compound Name | 2-[[2-(4-ethylphenyl)piperazin-1-yl]methyl]-5-methylpyrazine;dihydrochloride |
|---|---|
| PubChem CID | 120758162 |
| Molecular Formula | C18H26Cl2N4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[[2-(4-ethylphenyl)piperazin-1-yl]methyl]-5-methylpyrazine;dihydrochloride |
| SMILES | CCc1ccc(C2CNCCN2Cc2cnc(C)cn2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H24N4.2ClH/c1-3-15-4-6-16(7-5-15)18-12-19-8-9-22(18)13-17-11-20-14(2)10-21-17;;/h4-7,10-11,18-19H,3,8-9,12-13H2,1-2H3;2*1H |
| InChIKey | BIHGBLMAPNNTHC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |