C19H29N5 — CID 120846597
1-[(1-tert-butyltriazol-4-yl)methyl]-2-(4-ethylphenyl)piperazine (PubChem CID 120846597) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-[(1-tert-butyltriazol-4-yl)methyl]-2-(4-ethylphenyl)piperazine.
| Compound Name | 1-[(1-tert-butyltriazol-4-yl)methyl]-2-(4-ethylphenyl)piperazine |
|---|---|
| PubChem CID | 120846597 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 1-[(1-tert-butyltriazol-4-yl)methyl]-2-(4-ethylphenyl)piperazine |
| SMILES | CCc1ccc(C2CNCCN2Cc2cn(C(C)(C)C)nn2)cc1 |
| InChI | InChI=1S/C19H29N5/c1-5-15-6-8-16(9-7-15)18-12-20-10-11-23(18)13-17-14-24(22-21-17)19(2,3)4/h6-9,14,18,20H,5,10-13H2,1-4H3 |
| InChIKey | KLYBJZRVNFFMFF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |