C17H24N4 — CID 120769026
2-(4-ethylphenyl)-1-[(5-methyl-1H-pyrazol-4-yl)methyl]piperazine (PubChem CID 120769026) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-[(5-methyl-1H-pyrazol-4-yl)methyl]piperazine.
| Compound Name | 2-(4-ethylphenyl)-1-[(5-methyl-1H-pyrazol-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 120769026 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-(4-ethylphenyl)-1-[(5-methyl-1H-pyrazol-4-yl)methyl]piperazine |
| SMILES | CCc1ccc(C2CNCCN2Cc2cn[nH]c2C)cc1 |
| InChI | InChI=1S/C17H24N4/c1-3-14-4-6-15(7-5-14)17-11-18-8-9-21(17)12-16-10-19-20-13(16)2/h4-7,10,17-18H,3,8-9,11-12H2,1-2H3,(H,19,20) |
| InChIKey | FFEVWYMHZIYRMC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |