C22H30N2O3 — CID 120769082
2-(4-ethylphenyl)-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 120769082) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 2-(4-ethylphenyl)-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 120769082 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2-(4-ethylphenyl)-1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | CCc1ccc(C2CNCCN2Cc2ccc(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C22H30N2O3/c1-5-16-6-8-17(9-7-16)19-14-23-12-13-24(19)15-18-10-11-20(25-2)22(27-4)21(18)26-3/h6-11,19,23H,5,12-15H2,1-4H3 |
| InChIKey | FUBNOOCIQJMXBM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |