C20H21N5O — CID 120746401
[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(1-benzyltriazol-4-yl)methanone (PubChem CID 120746401) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(1-benzyltriazol-4-yl)methanone.
| Compound Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(1-benzyltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 120746401 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(1-benzyltriazol-4-yl)methanone |
| SMILES | N[C@@H]1CN(C(=O)c2cn(Cc3ccccc3)nn2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H21N5O/c21-18-13-24(12-17(18)16-9-5-2-6-10-16)20(26)19-14-25(23-22-19)11-15-7-3-1-4-8-15/h1-10,14,17-18H,11-13,21H2/t17-,18+/m0/s1 |
| InChIKey | CGQDHDZDXVZZHY-ZWKOTPCHSA-N |
| XLogP | 1.89 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |