C20H24N2O — CID 120746415
[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(4-propylphenyl)methanone (PubChem CID 120746415) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(4-propylphenyl)methanone.
| Compound Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(4-propylphenyl)methanone |
|---|---|
| PubChem CID | 120746415 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(4-propylphenyl)methanone |
| SMILES | CCCc1ccc(C(=O)N2C[C@@H](N)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H24N2O/c1-2-6-15-9-11-17(12-10-15)20(23)22-13-18(19(21)14-22)16-7-4-3-5-8-16/h3-5,7-12,18-19H,2,6,13-14,21H2,1H3/t18-,19+/m0/s1 |
| InChIKey | MAPZPVSUQWBQDD-RBUKOAKNSA-N |
| XLogP | 3.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |