C21H23ClN4O3 — CID 120749703
3-[[4-[(3S,4R)-3-amino-4-phenylpyrrolidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione;hydrochloride (PubChem CID 120749703) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 3-[[4-[(3S,4R)-3-amino-4-phenylpyrrolidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[[4-[(3S,4R)-3-amino-4-phenylpyrrolidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 120749703 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 3-[[4-[(3S,4R)-3-amino-4-phenylpyrrolidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.N[C@@H]1CN(C(=O)c2ccc(CN3C(=O)CNC3=O)cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22N4O3.ClH/c22-18-13-24(12-17(18)15-4-2-1-3-5-15)20(27)16-8-6-14(7-9-16)11-25-19(26)10-23-21(25)28;/h1-9,17-18H,10-13,22H2,(H,23,28);1H/t17-,18+;/m0./s1 |
| InChIKey | UZPBAKCOLSHPEK-CJRXIRLBSA-N |
| XLogP | 1.73 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|