C15H15IN2OS — CID 120746789
[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone (PubChem CID 120746789) has the molecular formula C15H15IN2OS and a molecular weight of 398.27 g/mol. Its IUPAC name is [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone.
| Compound Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 120746789 |
| Molecular Formula | C15H15IN2OS |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(5-iodothiophen-3-yl)methanone |
| SMILES | N[C@@H]1CN(C(=O)c2csc(I)c2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H15IN2OS/c16-14-6-11(9-20-14)15(19)18-7-12(13(17)8-18)10-4-2-1-3-5-10/h1-6,9,12-13H,7-8,17H2/t12-,13+/m0/s1 |
| InChIKey | KKGBHYCLBSCHCS-QWHCGFSZSA-N |
| XLogP | 2.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|