C15H20N2O2 — CID 120747151
[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 120747151) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 120747151 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | N[C@@H]1CN(C(=O)C2CCCO2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c16-13-10-17(15(18)14-7-4-8-19-14)9-12(13)11-5-2-1-3-6-11/h1-3,5-6,12-14H,4,7-10,16H2/t12-,13+,14?/m0/s1 |
| InChIKey | PKXVDDYDFMHHCF-WLDKUNSKSA-N |
| XLogP | 1.12 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |