C15H19NO3 — CID 51710322
[(2S)-oxolan-2-yl]-[(2S)-2-phenylmorpholin-4-yl]methanone (PubChem CID 51710322) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]-[(2S)-2-phenylmorpholin-4-yl]methanone.
| Compound Name | [(2S)-oxolan-2-yl]-[(2S)-2-phenylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 51710322 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [(2S)-oxolan-2-yl]-[(2S)-2-phenylmorpholin-4-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1CCO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C15H19NO3/c17-15(13-7-4-9-18-13)16-8-10-19-14(11-16)12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2/t13-,14+/m0/s1 |
| InChIKey | RABGZLXTPPMVAD-UONOGXRCSA-N |
| XLogP | 1.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |