C14H19ClN4O — CID 120751127
N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-N-benzylprop-2-en-1-amine;hydrochloride (PubChem CID 120751127) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-N-benzylprop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-N-benzylprop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120751127 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-N-benzylprop-2-en-1-amine;hydrochloride |
| SMILES | C=CCN(Cc1ccccc1)Cc1noc(CN)n1.Cl |
| InChI | InChI=1S/C14H18N4O.ClH/c1-2-8-18(10-12-6-4-3-5-7-12)11-13-16-14(9-15)19-17-13;/h2-7H,1,8-11,15H2;1H |
| InChIKey | NPGCIORPEXGGQI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|