C17H17N3O2 — CID 134043607
N-benzyl-N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-en-1-amine (PubChem CID 134043607) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-benzyl-N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-en-1-amine.
| Compound Name | N-benzyl-N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 134043607 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-benzyl-N-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-en-1-amine |
| SMILES | C=CCN(Cc1ccccc1)Cc1nc(-c2ccco2)no1 |
| InChI | InChI=1S/C17H17N3O2/c1-2-10-20(12-14-7-4-3-5-8-14)13-16-18-17(19-22-16)15-9-6-11-21-15/h2-9,11H,1,10,12-13H2 |
| InChIKey | NGVDKVPUAFOUKR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|