C20H19N3O3 — CID 47000014
N-(1,3-benzodioxol-4-ylmethyl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine (PubChem CID 47000014) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 47000014 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCN(Cc1nc(-c2ccccc2)no1)Cc1cccc2c1OCO2 |
| InChI | InChI=1S/C20H19N3O3/c1-2-11-23(12-16-9-6-10-17-19(16)25-14-24-17)13-18-21-20(22-26-18)15-7-4-3-5-8-15/h2-10H,1,11-14H2 |
| InChIKey | HQVGBXZKKVDRFA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|