C21H28ClN3O2 — CID 120753875
2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide;hydrochloride (PubChem CID 120753875) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120753875 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-(1-phenylethyl)acetamide;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1CC(=O)NC(C)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27N3O2.ClH/c1-16(17-8-4-3-5-9-17)23-21(25)15-24-13-12-22-14-19(24)18-10-6-7-11-20(18)26-2;/h3-11,16,19,22H,12-15H2,1-2H3,(H,23,25);1H |
| InChIKey | OEVHGFDBDLQBLC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |