C21H32N4O3 — CID 120753177
2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)acetamide (PubChem CID 120753177) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)acetamide.
| Compound Name | 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 120753177 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)piperazin-1-yl]-N-(1-oxo-1-piperidin-1-ylpropan-2-yl)acetamide |
| SMILES | COc1ccccc1C1CNCCN1CC(=O)NC(C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H32N4O3/c1-16(21(27)24-11-6-3-7-12-24)23-20(26)15-25-13-10-22-14-18(25)17-8-4-5-9-19(17)28-2/h4-5,8-9,16,18,22H,3,6-7,10-15H2,1-2H3,(H,23,26) |
| InChIKey | NMQIXRZGSIZHMP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |