C20H31ClN4O3 — CID 120753392
N-(cyclohexylcarbamoyl)-2-[2-(2-methoxyphenyl)piperazin-1-yl]acetamide;hydrochloride (PubChem CID 120753392) has the molecular formula C20H31ClN4O3 and a molecular weight of 410.95 g/mol. Its IUPAC name is N-(cyclohexylcarbamoyl)-2-[2-(2-methoxyphenyl)piperazin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(cyclohexylcarbamoyl)-2-[2-(2-methoxyphenyl)piperazin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120753392 |
| Molecular Formula | C20H31ClN4O3 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-(cyclohexylcarbamoyl)-2-[2-(2-methoxyphenyl)piperazin-1-yl]acetamide;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1CC(=O)NC(=O)NC1CCCCC1.Cl |
| InChI | InChI=1S/C20H30N4O3.ClH/c1-27-18-10-6-5-9-16(18)17-13-21-11-12-24(17)14-19(25)23-20(26)22-15-7-3-2-4-8-15;/h5-6,9-10,15,17,21H,2-4,7-8,11-14H2,1H3,(H2,22,23,25,26);1H |
| InChIKey | PFWDRDAQOWJIKQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |