C19H31ClN4O — CID 120754378
N-methyl-N-(4-methylcyclohexyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 120754378) has the molecular formula C19H31ClN4O and a molecular weight of 366.94 g/mol. Its IUPAC name is N-methyl-N-(4-methylcyclohexyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-methyl-N-(4-methylcyclohexyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120754378 |
| Molecular Formula | C19H31ClN4O |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-methyl-N-(4-methylcyclohexyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | CC1CCC(N(C)C(=O)CN2CCNCC2c2cccnc2)CC1.Cl |
| InChI | InChI=1S/C19H30N4O.ClH/c1-15-5-7-17(8-6-15)22(2)19(24)14-23-11-10-21-13-18(23)16-4-3-9-20-12-16;/h3-4,9,12,15,17-18,21H,5-8,10-11,13-14H2,1-2H3;1H |
| InChIKey | RTZVREOPQZKFMV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |