C17H28ClN3 — CID 120768179
1-[(2-methylcyclohexyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120768179) has the molecular formula C17H28ClN3 and a molecular weight of 309.88 g/mol. Its IUPAC name is 1-[(2-methylcyclohexyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-[(2-methylcyclohexyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120768179 |
| Molecular Formula | C17H28ClN3 |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 1-[(2-methylcyclohexyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | CC1CCCCC1CN1CCNCC1c1cccnc1.Cl |
| InChI | InChI=1S/C17H27N3.ClH/c1-14-5-2-3-6-16(14)13-20-10-9-19-12-17(20)15-7-4-8-18-11-15;/h4,7-8,11,14,16-17,19H,2-3,5-6,9-10,12-13H2,1H3;1H |
| InChIKey | SWYBDRKMVFJAPO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |