C17H19Cl2N5O3 — CID 120755599
N-(4-chloro-3-nitrophenyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 120755599) has the molecular formula C17H19Cl2N5O3 and a molecular weight of 412.28 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120755599 |
| Molecular Formula | C17H19Cl2N5O3 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCNCC1c1cccnc1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18ClN5O3.ClH/c18-14-4-3-13(8-15(14)23(25)26)21-17(24)11-22-7-6-20-10-16(22)12-2-1-5-19-9-12;/h1-5,8-9,16,20H,6-7,10-11H2,(H,21,24);1H |
| InChIKey | UVZXXHUUQBWZAF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|