C17H18Cl2N4O — CID 120755163
N-(2,4-dichlorophenyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide (PubChem CID 120755163) has the molecular formula C17H18Cl2N4O and a molecular weight of 365.26 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 120755163 |
| Molecular Formula | C17H18Cl2N4O |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCNCC1c1cccnc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N4O/c18-13-3-4-15(14(19)8-13)22-17(24)11-23-7-6-21-10-16(23)12-2-1-5-20-9-12/h1-5,8-9,16,21H,6-7,10-11H2,(H,22,24) |
| InChIKey | KRYMOKACZQUQIZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |