C18H20Cl2N4O — CID 120754693
N-(2,5-dichlorophenyl)-3-(2-pyridin-3-ylpiperazin-1-yl)propanamide (PubChem CID 120754693) has the molecular formula C18H20Cl2N4O and a molecular weight of 379.29 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-3-(2-pyridin-3-ylpiperazin-1-yl)propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-3-(2-pyridin-3-ylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 120754693 |
| Molecular Formula | C18H20Cl2N4O |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(2,5-dichlorophenyl)-3-(2-pyridin-3-ylpiperazin-1-yl)propanamide |
| SMILES | O=C(CCN1CCNCC1c1cccnc1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H20Cl2N4O/c19-14-3-4-15(20)16(10-14)23-18(25)5-8-24-9-7-22-12-17(24)13-2-1-6-21-11-13/h1-4,6,10-11,17,22H,5,7-9,12H2,(H,23,25) |
| InChIKey | ZJRTUWREZDJYFY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |