C16H22ClN5O2S — CID 120757602
N-[2-[2-(2-chlorophenyl)piperazin-1-yl]ethyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 120757602) has the molecular formula C16H22ClN5O2S and a molecular weight of 383.91 g/mol. Its IUPAC name is N-[2-[2-(2-chlorophenyl)piperazin-1-yl]ethyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[2-[2-(2-chlorophenyl)piperazin-1-yl]ethyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 120757602 |
| Molecular Formula | C16H22ClN5O2S |
| Molecular Weight | 383.91 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[2-[2-(2-chlorophenyl)piperazin-1-yl]ethyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCCN2CCNCC2c2ccccc2Cl)cn1 |
| InChI | InChI=1S/C16H22ClN5O2S/c1-21-12-13(10-19-21)25(23,24)20-7-9-22-8-6-18-11-16(22)14-4-2-3-5-15(14)17/h2-5,10,12,16,18,20H,6-9,11H2,1H3 |
| InChIKey | CLIDOFWJTSEDKA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.91 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |