C19H25ClN2 — CID 120761196
(3S,4R)-4-phenyl-1-(1-phenylpropyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 120761196) has the molecular formula C19H25ClN2 and a molecular weight of 316.88 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-(1-phenylpropyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S,4R)-4-phenyl-1-(1-phenylpropyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120761196 |
| Molecular Formula | C19H25ClN2 |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (3S,4R)-4-phenyl-1-(1-phenylpropyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | CCC(c1ccccc1)N1C[C@@H](N)[C@H](c2ccccc2)C1.Cl |
| InChI | InChI=1S/C19H24N2.ClH/c1-2-19(16-11-7-4-8-12-16)21-13-17(18(20)14-21)15-9-5-3-6-10-15;/h3-12,17-19H,2,13-14,20H2,1H3;1H/t17-,18+,19?;/m0./s1 |
| InChIKey | HAISTTSXWMZKIV-DVPITABRSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |