C20H22N4O2S — CID 120766302
[(3R,4R)-4-phenyl-1-(1-phenylpyrazol-4-yl)sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 120766302) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is [(3R,4R)-4-phenyl-1-(1-phenylpyrazol-4-yl)sulfonylpyrrolidin-3-yl]methanamine.
| Compound Name | [(3R,4R)-4-phenyl-1-(1-phenylpyrazol-4-yl)sulfonylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120766302 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [(3R,4R)-4-phenyl-1-(1-phenylpyrazol-4-yl)sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | NC[C@@H]1CN(S(=O)(=O)c2cnn(-c3ccccc3)c2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H22N4O2S/c21-11-17-13-23(15-20(17)16-7-3-1-4-8-16)27(25,26)19-12-22-24(14-19)18-9-5-2-6-10-18/h1-10,12,14,17,20H,11,13,15,21H2/t17-,20+/m1/s1 |
| InChIKey | GFHXYGVVNSBDGV-XLIONFOSSA-N |
| XLogP | 2.24 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |