C18H23ClN2O2S — CID 120766936
(3S,4R)-4-phenyl-1-(2-phenylethylsulfonyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 120766936) has the molecular formula C18H23ClN2O2S and a molecular weight of 366.91 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-(2-phenylethylsulfonyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S,4R)-4-phenyl-1-(2-phenylethylsulfonyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120766936 |
| Molecular Formula | C18H23ClN2O2S |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3S,4R)-4-phenyl-1-(2-phenylethylsulfonyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CN(S(=O)(=O)CCc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H22N2O2S.ClH/c19-18-14-20(13-17(18)16-9-5-2-6-10-16)23(21,22)12-11-15-7-3-1-4-8-15;/h1-10,17-18H,11-14,19H2;1H/t17-,18+;/m0./s1 |
| InChIKey | HABVZXLFSJJJOK-CJRXIRLBSA-N |
| XLogP | 2.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |