C21H26ClFN2O3 — CID 120768431
ethyl 2-[4-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]phenoxy]acetate;hydrochloride (PubChem CID 120768431) has the molecular formula C21H26ClFN2O3 and a molecular weight of 408.90 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]phenoxy]acetate;hydrochloride.
| Compound Name | ethyl 2-[4-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]phenoxy]acetate;hydrochloride |
|---|---|
| PubChem CID | 120768431 |
| Molecular Formula | C21H26ClFN2O3 |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | ethyl 2-[4-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]phenoxy]acetate;hydrochloride |
| SMILES | CCOC(=O)COc1ccc(CN2CCNCC2c2cccc(F)c2)cc1.Cl |
| InChI | InChI=1S/C21H25FN2O3.ClH/c1-2-26-21(25)15-27-19-8-6-16(7-9-19)14-24-11-10-23-13-20(24)17-4-3-5-18(22)12-17;/h3-9,12,20,23H,2,10-11,13-15H2,1H3;1H |
| InChIKey | BHIDCQXMJBZPFQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |