C17H19FN2O3 — CID 120768634
methyl 5-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]furan-2-carboxylate (PubChem CID 120768634) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is methyl 5-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 120768634 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl 5-[[2-(3-fluorophenyl)piperazin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCNCC2c2cccc(F)c2)o1 |
| InChI | InChI=1S/C17H19FN2O3/c1-22-17(21)16-6-5-14(23-16)11-20-8-7-19-10-15(20)12-3-2-4-13(18)9-12/h2-6,9,15,19H,7-8,10-11H2,1H3 |
| InChIKey | UFHFVULRXCXSEQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |