C18H23ClFN3O — CID 120768485
2-(3-fluorophenyl)-1-[(4-methoxy-6-methyl-2-pyridinyl)methyl]piperazine;hydrochloride (PubChem CID 120768485) has the molecular formula C18H23ClFN3O and a molecular weight of 351.85 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-[(4-methoxy-6-methyl-2-pyridinyl)methyl]piperazine;hydrochloride.
| Compound Name | 2-(3-fluorophenyl)-1-[(4-methoxy-6-methyl-2-pyridinyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120768485 |
| Molecular Formula | C18H23ClFN3O |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-(3-fluorophenyl)-1-[(4-methoxy-6-methyl-2-pyridinyl)methyl]piperazine;hydrochloride |
| SMILES | COc1cc(C)nc(CN2CCNCC2c2cccc(F)c2)c1.Cl |
| InChI | InChI=1S/C18H22FN3O.ClH/c1-13-8-17(23-2)10-16(21-13)12-22-7-6-20-11-18(22)14-4-3-5-15(19)9-14;/h3-5,8-10,18,20H,6-7,11-12H2,1-2H3;1H |
| InChIKey | NVXUIFVOUDRLSX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |