C15H18ClF3N4 — CID 120768691
1-[[1-(difluoromethyl)pyrazol-3-yl]methyl]-2-(3-fluorophenyl)piperazine;hydrochloride (PubChem CID 120768691) has the molecular formula C15H18ClF3N4 and a molecular weight of 346.78 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)pyrazol-3-yl]methyl]-2-(3-fluorophenyl)piperazine;hydrochloride.
| Compound Name | 1-[[1-(difluoromethyl)pyrazol-3-yl]methyl]-2-(3-fluorophenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120768691 |
| Molecular Formula | C15H18ClF3N4 |
| Molecular Weight | 346.78 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[[1-(difluoromethyl)pyrazol-3-yl]methyl]-2-(3-fluorophenyl)piperazine;hydrochloride |
| SMILES | Cl.Fc1cccc(C2CNCCN2Cc2ccn(C(F)F)n2)c1 |
| InChI | InChI=1S/C15H17F3N4.ClH/c16-12-3-1-2-11(8-12)14-9-19-5-7-21(14)10-13-4-6-22(20-13)15(17)18;/h1-4,6,8,14-15,19H,5,7,9-10H2;1H |
| InChIKey | ZQOHTJILOWPOFM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |