C20H20FN3 — CID 120769922
(3S,4R)-1-[(5-fluoroquinolin-8-yl)methyl]-4-phenylpyrrolidin-3-amine (PubChem CID 120769922) has the molecular formula C20H20FN3 and a molecular weight of 321.40 g/mol. Its IUPAC name is (3S,4R)-1-[(5-fluoroquinolin-8-yl)methyl]-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[(5-fluoroquinolin-8-yl)methyl]-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120769922 |
| Molecular Formula | C20H20FN3 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (3S,4R)-1-[(5-fluoroquinolin-8-yl)methyl]-4-phenylpyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(Cc2ccc(F)c3cccnc23)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H20FN3/c21-18-9-8-15(20-16(18)7-4-10-23-20)11-24-12-17(19(22)13-24)14-5-2-1-3-6-14/h1-10,17,19H,11-13,22H2/t17-,19+/m0/s1 |
| InChIKey | PLIONDFUNPQIDC-PKOBYXMFSA-N |
| XLogP | 3.30 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |