C13H15FIN3 — CID 120770571
N-[3-(3-fluorophenyl)prop-2-ynyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 120770571) has the molecular formula C13H15FIN3 and a molecular weight of 359.19 g/mol. Its IUPAC name is N-[3-(3-fluorophenyl)prop-2-ynyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[3-(3-fluorophenyl)prop-2-ynyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120770571 |
| Molecular Formula | C13H15FIN3 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | N-[3-(3-fluorophenyl)prop-2-ynyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Fc1cccc(C#CCNC2=NCCCN2)c1.I |
| InChI | InChI=1S/C13H14FN3.HI/c14-12-6-1-4-11(10-12)5-2-7-15-13-16-8-3-9-17-13;/h1,4,6,10H,3,7-9H2,(H2,15,16,17);1H |
| InChIKey | OBRLDKZMGHUMLE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|