C19H29ClN4O — CID 120771058
2-[2-(3-chlorophenyl)piperazin-1-yl]-N-(1-ethylpiperidin-4-yl)acetamide (PubChem CID 120771058) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)piperazin-1-yl]-N-(1-ethylpiperidin-4-yl)acetamide.
| Compound Name | 2-[2-(3-chlorophenyl)piperazin-1-yl]-N-(1-ethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 120771058 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-[2-(3-chlorophenyl)piperazin-1-yl]-N-(1-ethylpiperidin-4-yl)acetamide |
| SMILES | CCN1CCC(NC(=O)CN2CCNCC2c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H29ClN4O/c1-2-23-9-6-17(7-10-23)22-19(25)14-24-11-8-21-13-18(24)15-4-3-5-16(20)12-15/h3-5,12,17-18,21H,2,6-11,13-14H2,1H3,(H,22,25) |
| InChIKey | HVXLIAYEBAFHBO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |