C21H26ClN3O2 — CID 120771238
2-[2-(3-chlorophenyl)piperazin-1-yl]-N-[[4-(methoxymethyl)phenyl]methyl]acetamide (PubChem CID 120771238) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)piperazin-1-yl]-N-[[4-(methoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[2-(3-chlorophenyl)piperazin-1-yl]-N-[[4-(methoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 120771238 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[2-(3-chlorophenyl)piperazin-1-yl]-N-[[4-(methoxymethyl)phenyl]methyl]acetamide |
| SMILES | COCc1ccc(CNC(=O)CN2CCNCC2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-27-15-17-7-5-16(6-8-17)12-24-21(26)14-25-10-9-23-13-20(25)18-3-2-4-19(22)11-18/h2-8,11,20,23H,9-10,12-15H2,1H3,(H,24,26) |
| InChIKey | SNDBSPMRLCCHGU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |