C20H24ClN3O — CID 120771242
3-[[2-(3-chlorophenyl)piperazin-1-yl]methyl]-N,N-dimethylbenzamide (PubChem CID 120771242) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)piperazin-1-yl]methyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-(3-chlorophenyl)piperazin-1-yl]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 120771242 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)piperazin-1-yl]methyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(CN2CCNCC2c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C20H24ClN3O/c1-23(2)20(25)17-7-3-5-15(11-17)14-24-10-9-22-13-19(24)16-6-4-8-18(21)12-16/h3-8,11-12,19,22H,9-10,13-14H2,1-2H3 |
| InChIKey | YYLNEROWFWDXRV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |