C15H24ClFN2 — CID 120771726
[1-[1-(4-fluorophenyl)propyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120771726) has the molecular formula C15H24ClFN2 and a molecular weight of 286.82 g/mol. Its IUPAC name is [1-[1-(4-fluorophenyl)propyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[1-(4-fluorophenyl)propyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120771726 |
| Molecular Formula | C15H24ClFN2 |
| Molecular Weight | 286.82 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [1-[1-(4-fluorophenyl)propyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CCC(c1ccc(F)cc1)N1CCC(C)(CN)C1.Cl |
| InChI | InChI=1S/C15H23FN2.ClH/c1-3-14(12-4-6-13(16)7-5-12)18-9-8-15(2,10-17)11-18;/h4-7,14H,3,8-11,17H2,1-2H3;1H |
| InChIKey | JGHFSGQLKDSSLE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |