C16H25FN2 — CID 63156191
2-(4-ethyl-4-methylpiperidin-1-yl)-2-(4-fluorophenyl)ethanamine (PubChem CID 63156191) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(4-ethyl-4-methylpiperidin-1-yl)-2-(4-fluorophenyl)ethanamine.
| Compound Name | 2-(4-ethyl-4-methylpiperidin-1-yl)-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 63156191 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 2-(4-ethyl-4-methylpiperidin-1-yl)-2-(4-fluorophenyl)ethanamine |
| SMILES | CCC1(C)CCN(C(CN)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H25FN2/c1-3-16(2)8-10-19(11-9-16)15(12-18)13-4-6-14(17)7-5-13/h4-7,15H,3,8-12,18H2,1-2H3 |
| InChIKey | WUQAKYOJTRCNAB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |