C16H26ClN3O — CID 120772553
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-methyl-N-phenylpropanamide;hydrochloride (PubChem CID 120772553) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-methyl-N-phenylpropanamide;hydrochloride.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-methyl-N-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120772553 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-methyl-N-phenylpropanamide;hydrochloride |
| SMILES | CC(C(=O)N(C)c1ccccc1)N1CCC(C)(CN)C1.Cl |
| InChI | InChI=1S/C16H25N3O.ClH/c1-13(19-10-9-16(2,11-17)12-19)15(20)18(3)14-7-5-4-6-8-14;/h4-8,13H,9-12,17H2,1-3H3;1H |
| InChIKey | DHVLSAZATJQWQC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |