C18H25Cl2N3O — CID 120773386
[3-methyl-1-[(2-pyridin-3-yloxyphenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride (PubChem CID 120773386) has the molecular formula C18H25Cl2N3O and a molecular weight of 370.32 g/mol. Its IUPAC name is [3-methyl-1-[(2-pyridin-3-yloxyphenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride.
| Compound Name | [3-methyl-1-[(2-pyridin-3-yloxyphenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 120773386 |
| Molecular Formula | C18H25Cl2N3O |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [3-methyl-1-[(2-pyridin-3-yloxyphenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrochloride |
| SMILES | CC1(CN)CCN(Cc2ccccc2Oc2cccnc2)C1.Cl.Cl |
| InChI | InChI=1S/C18H23N3O.2ClH/c1-18(13-19)8-10-21(14-18)12-15-5-2-3-7-17(15)22-16-6-4-9-20-11-16;;/h2-7,9,11H,8,10,12-14,19H2,1H3;2*1H |
| InChIKey | NQYOGKPFROQKQO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |