C16H23ClN4O3 — CID 120775302
2-(4-amino-3,3-dimethylpiperidin-1-yl)-N-(2-chloro-5-nitrophenyl)propanamide (PubChem CID 120775302) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-(4-amino-3,3-dimethylpiperidin-1-yl)-N-(2-chloro-5-nitrophenyl)propanamide.
| Compound Name | 2-(4-amino-3,3-dimethylpiperidin-1-yl)-N-(2-chloro-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 120775302 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-(4-amino-3,3-dimethylpiperidin-1-yl)-N-(2-chloro-5-nitrophenyl)propanamide |
| SMILES | CC(C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)N1CCC(N)C(C)(C)C1 |
| InChI | InChI=1S/C16H23ClN4O3/c1-10(20-7-6-14(18)16(2,3)9-20)15(22)19-13-8-11(21(23)24)4-5-12(13)17/h4-5,8,10,14H,6-7,9,18H2,1-3H3,(H,19,22) |
| InChIKey | NVFMHLBVWMVHGC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|