C13H17FN2O3S — CID 120778330
(4aR,7aS)-4-[(2-fluorophenyl)methylsulfonyl]-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (PubChem CID 120778330) has the molecular formula C13H17FN2O3S and a molecular weight of 300.35 g/mol. Its IUPAC name is (4aR,7aS)-4-[(2-fluorophenyl)methylsulfonyl]-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-4-[(2-fluorophenyl)methylsulfonyl]-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 120778330 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (4aR,7aS)-4-[(2-fluorophenyl)methylsulfonyl]-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| SMILES | O=S(=O)(Cc1ccccc1F)N1CCO[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C13H17FN2O3S/c14-11-4-2-1-3-10(11)9-20(17,18)16-5-6-19-13-8-15-7-12(13)16/h1-4,12-13,15H,5-9H2/t12-,13+/m1/s1 |
| InChIKey | LLGZUXJBHSINCU-OLZOCXBDSA-N |
| XLogP | 0.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |