C14H20ClN3O3S — CID 120778896
3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-chlorobenzamide (PubChem CID 120778896) has the molecular formula C14H20ClN3O3S and a molecular weight of 345.85 g/mol. Its IUPAC name is 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-chlorobenzamide.
| Compound Name | 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-chlorobenzamide |
|---|---|
| PubChem CID | 120778896 |
| Molecular Formula | C14H20ClN3O3S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-chlorobenzamide |
| SMILES | CC1(C)CN(S(=O)(=O)c2cc(Cl)cc(C(N)=O)c2)CCC1N |
| InChI | InChI=1S/C14H20ClN3O3S/c1-14(2)8-18(4-3-12(14)16)22(20,21)11-6-9(13(17)19)5-10(15)7-11/h5-7,12H,3-4,8,16H2,1-2H3,(H2,17,19) |
| InChIKey | YAHDGJLPQUISNB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |