C12H21N5O4S — CID 120778970
1-(1-ethyl-3-nitropyrazol-4-yl)sulfonyl-3,3-dimethylpiperidin-4-amine (PubChem CID 120778970) has the molecular formula C12H21N5O4S and a molecular weight of 331.40 g/mol. Its IUPAC name is 1-(1-ethyl-3-nitropyrazol-4-yl)sulfonyl-3,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(1-ethyl-3-nitropyrazol-4-yl)sulfonyl-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 120778970 |
| Molecular Formula | C12H21N5O4S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-(1-ethyl-3-nitropyrazol-4-yl)sulfonyl-3,3-dimethylpiperidin-4-amine |
| SMILES | CCn1cc(S(=O)(=O)N2CCC(N)C(C)(C)C2)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H21N5O4S/c1-4-15-7-9(11(14-15)17(18)19)22(20,21)16-6-5-10(13)12(2,3)8-16/h7,10H,4-6,8,13H2,1-3H3 |
| InChIKey | QUEXFAPZMKFFJB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 124.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|