C17H26N2O3 — CID 120780403
ethyl 2-[4-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]methyl]phenoxy]acetate (PubChem CID 120780403) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is ethyl 2-[4-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 120780403 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | ethyl 2-[4-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(CN2CCC(C)(CN)C2)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-3-21-16(20)11-22-15-6-4-14(5-7-15)10-19-9-8-17(2,12-18)13-19/h4-7H,3,8-13,18H2,1-2H3 |
| InChIKey | SRRYQIZWHFPSCT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |