C14H21BrN2O2 — CID 120780657
5-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]methyl]-4-bromo-2-methoxyphenol (PubChem CID 120780657) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 5-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]methyl]-4-bromo-2-methoxyphenol.
| Compound Name | 5-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]methyl]-4-bromo-2-methoxyphenol |
|---|---|
| PubChem CID | 120780657 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 5-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]methyl]-4-bromo-2-methoxyphenol |
| SMILES | COc1cc(Br)c(CN2CCC(C)(CN)C2)cc1O |
| InChI | InChI=1S/C14H21BrN2O2/c1-14(8-16)3-4-17(9-14)7-10-5-12(18)13(19-2)6-11(10)15/h5-6,18H,3-4,7-9,16H2,1-2H3 |
| InChIKey | HXHPADHDJADTNY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |