C11H19N3S — CID 120782277
3,3-dimethyl-1-(1,3-thiazol-5-ylmethyl)piperidin-4-amine (PubChem CID 120782277) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1,3-thiazol-5-ylmethyl)piperidin-4-amine.
| Compound Name | 3,3-dimethyl-1-(1,3-thiazol-5-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 120782277 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3,3-dimethyl-1-(1,3-thiazol-5-ylmethyl)piperidin-4-amine |
| SMILES | CC1(C)CN(Cc2cncs2)CCC1N |
| InChI | InChI=1S/C11H19N3S/c1-11(2)7-14(4-3-10(11)12)6-9-5-13-8-15-9/h5,8,10H,3-4,6-7,12H2,1-2H3 |
| InChIKey | XERZSOQQDFQBNY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |