C11H19N3O — CID 120847083
3,3-dimethyl-1-(1,3-oxazol-4-ylmethyl)piperidin-4-amine (PubChem CID 120847083) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1,3-oxazol-4-ylmethyl)piperidin-4-amine.
| Compound Name | 3,3-dimethyl-1-(1,3-oxazol-4-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 120847083 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 3,3-dimethyl-1-(1,3-oxazol-4-ylmethyl)piperidin-4-amine |
| SMILES | CC1(C)CN(Cc2cocn2)CCC1N |
| InChI | InChI=1S/C11H19N3O/c1-11(2)7-14(4-3-10(11)12)5-9-6-15-8-13-9/h6,8,10H,3-5,7,12H2,1-2H3 |
| InChIKey | HRRGPNFMOUIJCY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |