C12H18N2O2S — CID 120784156
(2S,5R)-5-(aminomethyl)-N-(1-thiophen-2-ylethyl)oxolane-2-carboxamide (PubChem CID 120784156) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-(1-thiophen-2-ylethyl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-(1-thiophen-2-ylethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120784156 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-(1-thiophen-2-ylethyl)oxolane-2-carboxamide |
| SMILES | CC(NC(=O)[C@@H]1CC[C@H](CN)O1)c1cccs1 |
| InChI | InChI=1S/C12H18N2O2S/c1-8(11-3-2-6-17-11)14-12(15)10-5-4-9(7-13)16-10/h2-3,6,8-10H,4-5,7,13H2,1H3,(H,14,15)/t8?,9-,10+/m1/s1 |
| InChIKey | VYBGLNTUELRUJP-XVBQNVSMSA-N |
| XLogP | 1.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |