C12H16N2O4S — CID 115284832
2-[[5-(aminomethyl)oxolane-2-carbonyl]amino]-2-thiophen-2-ylacetic acid (PubChem CID 115284832) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-[[5-(aminomethyl)oxolane-2-carbonyl]amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[[5-(aminomethyl)oxolane-2-carbonyl]amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115284832 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[[5-(aminomethyl)oxolane-2-carbonyl]amino]-2-thiophen-2-ylacetic acid |
| SMILES | NCC1CCC(C(=O)NC(C(=O)O)c2cccs2)O1 |
| InChI | InChI=1S/C12H16N2O4S/c13-6-7-3-4-8(18-7)11(15)14-10(12(16)17)9-2-1-5-19-9/h1-2,5,7-8,10H,3-4,6,13H2,(H,14,15)(H,16,17) |
| InChIKey | BZSLUJAWFSNLEI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |