C10H18ClF3N2O3 — CID 120785667
(2S,5R)-5-(aminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-2-carboxamide;hydrochloride (PubChem CID 120785667) has the molecular formula C10H18ClF3N2O3 and a molecular weight of 306.71 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-2-carboxamide;hydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120785667 |
| Molecular Formula | C10H18ClF3N2O3 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]oxolane-2-carboxamide;hydrochloride |
| SMILES | Cl.NC[C@H]1CC[C@@H](C(=O)NCCOCC(F)(F)F)O1 |
| InChI | InChI=1S/C10H17F3N2O3.ClH/c11-10(12,13)6-17-4-3-15-9(16)8-2-1-7(5-14)18-8;/h7-8H,1-6,14H2,(H,15,16);1H/t7-,8+;/m1./s1 |
| InChIKey | PAXWGRGBDDOPDO-WLYNEOFISA-N |
| XLogP | 0.61 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|