C18H28ClN3O4 — CID 120787699
2-amino-N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120787699) has the molecular formula C18H28ClN3O4 and a molecular weight of 385.89 g/mol. Its IUPAC name is 2-amino-N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120787699 |
| Molecular Formula | C18H28ClN3O4 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-amino-N-ethyl-N-[2-(2-methoxyanilino)-2-oxoethyl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | CCN(CC(=O)Nc1ccccc1OC)C(=O)C(N)C1CCOCC1.Cl |
| InChI | InChI=1S/C18H27N3O4.ClH/c1-3-21(18(23)17(19)13-8-10-25-11-9-13)12-16(22)20-14-6-4-5-7-15(14)24-2;/h4-7,13,17H,3,8-12,19H2,1-2H3,(H,20,22);1H |
| InChIKey | BPTOYZMAMCVTKM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |